C13H18ClNO3S — CID 124627585
N-[(1S)-1-(4-chlorophenyl)propyl]-2-[(R)-2-hydroxyethylsulfinyl]acetamide (PubChem CID 124627585) has the molecular formula C13H18ClNO3S and a molecular weight of 303.81 g/mol. Its IUPAC name is N-[(1S)-1-(4-chlorophenyl)propyl]-2-[(R)-2-hydroxyethylsulfinyl]acetamide.
| Compound Name | N-[(1S)-1-(4-chlorophenyl)propyl]-2-[(R)-2-hydroxyethylsulfinyl]acetamide |
|---|---|
| PubChem CID | 124627585 |
| Molecular Formula | C13H18ClNO3S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | N-[(1S)-1-(4-chlorophenyl)propyl]-2-[(R)-2-hydroxyethylsulfinyl]acetamide |
| SMILES | CC[C@H](NC(=O)C[S@](=O)CCO)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H18ClNO3S/c1-2-12(10-3-5-11(14)6-4-10)15-13(17)9-19(18)8-7-16/h3-6,12,16H,2,7-9H2,1H3,(H,15,17)/t12-,19+/m0/s1 |
| InChIKey | PNYWPVRWKZUOIM-HXPMCKFVSA-N |
| XLogP | 1.65 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |