C11H24O3Si — CID 124629464
(3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypentan-2-one (PubChem CID 124629464) has the molecular formula C11H24O3Si and a molecular weight of 232.40 g/mol. Its IUPAC name is (3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypentan-2-one.
| Compound Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypentan-2-one |
|---|---|
| PubChem CID | 124629464 |
| Molecular Formula | C11H24O3Si |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypentan-2-one |
| SMILES | CC(=O)[C@@H](CCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H24O3Si/c1-9(13)10(7-8-12)14-15(5,6)11(2,3)4/h10,12H,7-8H2,1-6H3/t10-/m1/s1 |
| InChIKey | UUSDHTAHRYBCMB-SNVBAGLBSA-N |
| XLogP | 2.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|