C13H28O3Si — CID 134972438
(3R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,4-dimethylpentan-2-one (PubChem CID 134972438) has the molecular formula C13H28O3Si and a molecular weight of 260.45 g/mol. Its IUPAC name is (3R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,4-dimethylpentan-2-one.
| Compound Name | (3R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,4-dimethylpentan-2-one |
|---|---|
| PubChem CID | 134972438 |
| Molecular Formula | C13H28O3Si |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (3R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,4-dimethylpentan-2-one |
| SMILES | CC(=O)[C@H](O)C(C)(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H28O3Si/c1-10(14)11(15)13(5,6)9-16-17(7,8)12(2,3)4/h11,15H,9H2,1-8H3/t11-/m0/s1 |
| InChIKey | VEUFBEHHWOGLIF-NSHDSACASA-N |
| XLogP | 2.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|