C11H24O3Si — CID 101410808
(2S,4S)-2-hydroxy-5,5-dimethyl-4-trimethylsilyloxyhexan-3-one (PubChem CID 101410808) has the molecular formula C11H24O3Si and a molecular weight of 232.40 g/mol. Its IUPAC name is (2S,4S)-2-hydroxy-5,5-dimethyl-4-trimethylsilyloxyhexan-3-one.
| Compound Name | (2S,4S)-2-hydroxy-5,5-dimethyl-4-trimethylsilyloxyhexan-3-one |
|---|---|
| PubChem CID | 101410808 |
| Molecular Formula | C11H24O3Si |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (2S,4S)-2-hydroxy-5,5-dimethyl-4-trimethylsilyloxyhexan-3-one |
| SMILES | C[C@H](O)C(=O)[C@@H](O[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H24O3Si/c1-8(12)9(13)10(11(2,3)4)14-15(5,6)7/h8,10,12H,1-7H3/t8-,10+/m0/s1 |
| InChIKey | RBSHTVUULLFGBQ-WCBMZHEXSA-N |
| XLogP | 2.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|