C22H24N4O3 — CID 124632154
2-[(4R)-3-amino-5-oxo-1-phenyl-4H-pyrazol-4-yl]-N-(2-tert-butyl-6-methylphenyl)-2-oxoacetamide (PubChem CID 124632154) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-[(4R)-3-amino-5-oxo-1-phenyl-4H-pyrazol-4-yl]-N-(2-tert-butyl-6-methylphenyl)-2-oxoacetamide.
| Compound Name | 2-[(4R)-3-amino-5-oxo-1-phenyl-4H-pyrazol-4-yl]-N-(2-tert-butyl-6-methylphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 124632154 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-[(4R)-3-amino-5-oxo-1-phenyl-4H-pyrazol-4-yl]-N-(2-tert-butyl-6-methylphenyl)-2-oxoacetamide |
| SMILES | Cc1cccc(C(C)(C)C)c1NC(=O)C(=O)[C@@H]1C(=O)N(c2ccccc2)N=C1N |
| InChI | InChI=1S/C22H24N4O3/c1-13-9-8-12-15(22(2,3)4)17(13)24-20(28)18(27)16-19(23)25-26(21(16)29)14-10-6-5-7-11-14/h5-12,16H,1-4H3,(H2,23,25)(H,24,28)/t16-/m0/s1 |
| InChIKey | OXBIXTIUJWOSOJ-INIZCTEOSA-N |
| XLogP | 2.74 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|