C17H14N4O3 — CID 124527770
2-[(4S)-3-amino-5-oxo-1-phenyl-4H-pyrazol-4-yl]-2-oxo-N-phenylacetamide (PubChem CID 124527770) has the molecular formula C17H14N4O3 and a molecular weight of 322.32 g/mol. Its IUPAC name is 2-[(4S)-3-amino-5-oxo-1-phenyl-4H-pyrazol-4-yl]-2-oxo-N-phenylacetamide.
| Compound Name | 2-[(4S)-3-amino-5-oxo-1-phenyl-4H-pyrazol-4-yl]-2-oxo-N-phenylacetamide |
|---|---|
| PubChem CID | 124527770 |
| Molecular Formula | C17H14N4O3 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2-[(4S)-3-amino-5-oxo-1-phenyl-4H-pyrazol-4-yl]-2-oxo-N-phenylacetamide |
| SMILES | NC1=NN(c2ccccc2)C(=O)[C@@H]1C(=O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H14N4O3/c18-15-13(14(22)16(23)19-11-7-3-1-4-8-11)17(24)21(20-15)12-9-5-2-6-10-12/h1-10,13H,(H2,18,20)(H,19,23)/t13-/m1/s1 |
| InChIKey | OMYKKPFHAQECTN-CYBMUJFWSA-N |
| XLogP | 1.13 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|