C28H20Cl2N6O4 — CID 5387989
N-[(Z)-[1-(3-amino-5-oxo-1-phenyl-4H-pyrazol-4-yl)-2-(3,4-dichloroanilino)-2-oxoethylidene]amino]-3-hydroxynaphthalene-2-carboxamide (PubChem CID 5387989) has the molecular formula C28H20Cl2N6O4 and a molecular weight of 575.41 g/mol. Its IUPAC name is N-[(Z)-[1-(3-amino-5-oxo-1-phenyl-4H-pyrazol-4-yl)-2-(3,4-dichloroanilino)-2-oxoethylidene]amino]-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[(Z)-[1-(3-amino-5-oxo-1-phenyl-4H-pyrazol-4-yl)-2-(3,4-dichloroanilino)-2-oxoethylidene]amino]-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 5387989 |
| Molecular Formula | C28H20Cl2N6O4 |
| Molecular Weight | 575.41 g/mol |
| Exact Mass | 574.09 |
| IUPAC Name | N-[(Z)-[1-(3-amino-5-oxo-1-phenyl-4H-pyrazol-4-yl)-2-(3,4-dichloroanilino)-2-oxoethylidene]amino]-3-hydroxynaphthalene-2-carboxamide |
| SMILES | NC1=NN(c2ccccc2)C(=O)C1/C(=N/NC(=O)c1cc2ccccc2cc1O)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H20Cl2N6O4/c29-20-11-10-17(14-21(20)30)32-27(39)24(23-25(31)35-36(28(23)40)18-8-2-1-3-9-18)33-34-26(38)19-12-15-6-4-5-7-16(15)13-22(19)37/h1-14,23,37H,(H2,31,35)(H,32,39)(H,34,38)/b33-24- |
| InChIKey | ZBIWOJPWBGWDGV-GIBOGKFOSA-N |
| XLogP | 4.51 |
| TPSA | 149.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|