C19H14F3N3O3 — CID 124632165
2-[(4R)-3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl]-2-oxo-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 124632165) has the molecular formula C19H14F3N3O3 and a molecular weight of 389.33 g/mol. Its IUPAC name is 2-[(4R)-3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl]-2-oxo-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(4R)-3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl]-2-oxo-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 124632165 |
| Molecular Formula | C19H14F3N3O3 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 2-[(4R)-3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl]-2-oxo-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC1=NN(c2ccccc2)C(=O)[C@H]1C(=O)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H14F3N3O3/c1-11-15(18(28)25(24-11)14-8-3-2-4-9-14)16(26)17(27)23-13-7-5-6-12(10-13)19(20,21)22/h2-10,15H,1H3,(H,23,27)/t15-/m1/s1 |
| InChIKey | ZXIFZVKVEVAVFO-OAHLLOKOSA-N |
| XLogP | 3.25 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|