C23H22F2N4O2 — CID 139443205
N-[3-(1,1-difluoroethyl)phenyl]-3-methyl-1-[3-[3-(methylamino)prop-1-ynyl]phenyl]-5-oxo-4H-pyrazole-4-carboxamide (PubChem CID 139443205) has the molecular formula C23H22F2N4O2 and a molecular weight of 424.45 g/mol. Its IUPAC name is N-[3-(1,1-difluoroethyl)phenyl]-3-methyl-1-[3-[3-(methylamino)prop-1-ynyl]phenyl]-5-oxo-4H-pyrazole-4-carboxamide.
| Compound Name | N-[3-(1,1-difluoroethyl)phenyl]-3-methyl-1-[3-[3-(methylamino)prop-1-ynyl]phenyl]-5-oxo-4H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 139443205 |
| Molecular Formula | C23H22F2N4O2 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N-[3-(1,1-difluoroethyl)phenyl]-3-methyl-1-[3-[3-(methylamino)prop-1-ynyl]phenyl]-5-oxo-4H-pyrazole-4-carboxamide |
| SMILES | CNCC#Cc1cccc(N2N=C(C)C(C(=O)Nc3cccc(C(C)(F)F)c3)C2=O)c1 |
| InChI | InChI=1S/C23H22F2N4O2/c1-15-20(21(30)27-18-10-5-9-17(14-18)23(2,24)25)22(31)29(28-15)19-11-4-7-16(13-19)8-6-12-26-3/h4-5,7,9-11,13-14,20,26H,12H2,1-3H3,(H,27,30) |
| InChIKey | WTJGFGXRPBLOHB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|