C23H21F4N3O3 — CID 155311274
N-[3-[cyclobutyl(difluoro)methyl]phenyl]-1-[4-(difluoromethoxy)phenyl]-3-methyl-5-oxo-4H-pyrazole-4-carboxamide (PubChem CID 155311274) has the molecular formula C23H21F4N3O3 and a molecular weight of 463.43 g/mol. Its IUPAC name is N-[3-[cyclobutyl(difluoro)methyl]phenyl]-1-[4-(difluoromethoxy)phenyl]-3-methyl-5-oxo-4H-pyrazole-4-carboxamide.
| Compound Name | N-[3-[cyclobutyl(difluoro)methyl]phenyl]-1-[4-(difluoromethoxy)phenyl]-3-methyl-5-oxo-4H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 155311274 |
| Molecular Formula | C23H21F4N3O3 |
| Molecular Weight | 463.43 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | N-[3-[cyclobutyl(difluoro)methyl]phenyl]-1-[4-(difluoromethoxy)phenyl]-3-methyl-5-oxo-4H-pyrazole-4-carboxamide |
| SMILES | CC1=NN(c2ccc(OC(F)F)cc2)C(=O)C1C(=O)Nc1cccc(C(F)(F)C2CCC2)c1 |
| InChI | InChI=1S/C23H21F4N3O3/c1-13-19(21(32)30(29-13)17-8-10-18(11-9-17)33-22(24)25)20(31)28-16-7-3-6-15(12-16)23(26,27)14-4-2-5-14/h3,6-12,14,19,22H,2,4-5H2,1H3,(H,28,31) |
| InChIKey | APHVFKPZQQQJMF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|