C21H19F4N3O3 — CID 155311046
N-[3-(1,1-difluoroethyl)phenyl]-1-[4-(difluoromethoxy)phenyl]-3,4-dimethyl-5-oxopyrazole-4-carboxamide (PubChem CID 155311046) has the molecular formula C21H19F4N3O3 and a molecular weight of 437.39 g/mol. Its IUPAC name is N-[3-(1,1-difluoroethyl)phenyl]-1-[4-(difluoromethoxy)phenyl]-3,4-dimethyl-5-oxopyrazole-4-carboxamide.
| Compound Name | N-[3-(1,1-difluoroethyl)phenyl]-1-[4-(difluoromethoxy)phenyl]-3,4-dimethyl-5-oxopyrazole-4-carboxamide |
|---|---|
| PubChem CID | 155311046 |
| Molecular Formula | C21H19F4N3O3 |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | N-[3-(1,1-difluoroethyl)phenyl]-1-[4-(difluoromethoxy)phenyl]-3,4-dimethyl-5-oxopyrazole-4-carboxamide |
| SMILES | CC1=NN(c2ccc(OC(F)F)cc2)C(=O)C1(C)C(=O)Nc1cccc(C(C)(F)F)c1 |
| InChI | InChI=1S/C21H19F4N3O3/c1-12-20(2,17(29)26-14-6-4-5-13(11-14)21(3,24)25)18(30)28(27-12)15-7-9-16(10-8-15)31-19(22)23/h4-11,19H,1-3H3,(H,26,29) |
| InChIKey | SVQVIOJGFOFOLH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|