C21H19F2N3O3 — CID 155311546
4-fluoro-N-[3-(2-fluorobut-3-en-2-yl)phenyl]-1-(4-hydroxyphenyl)-3-methyl-5-oxopyrazole-4-carboxamide (PubChem CID 155311546) has the molecular formula C21H19F2N3O3 and a molecular weight of 399.40 g/mol. Its IUPAC name is 4-fluoro-N-[3-(2-fluorobut-3-en-2-yl)phenyl]-1-(4-hydroxyphenyl)-3-methyl-5-oxopyrazole-4-carboxamide.
| Compound Name | 4-fluoro-N-[3-(2-fluorobut-3-en-2-yl)phenyl]-1-(4-hydroxyphenyl)-3-methyl-5-oxopyrazole-4-carboxamide |
|---|---|
| PubChem CID | 155311546 |
| Molecular Formula | C21H19F2N3O3 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 4-fluoro-N-[3-(2-fluorobut-3-en-2-yl)phenyl]-1-(4-hydroxyphenyl)-3-methyl-5-oxopyrazole-4-carboxamide |
| SMILES | C=CC(C)(F)c1cccc(NC(=O)C2(F)C(=O)N(c3ccc(O)cc3)N=C2C)c1 |
| InChI | InChI=1S/C21H19F2N3O3/c1-4-20(3,22)14-6-5-7-15(12-14)24-18(28)21(23)13(2)25-26(19(21)29)16-8-10-17(27)11-9-16/h4-12,27H,1H2,2-3H3,(H,24,28) |
| InChIKey | XUGOQSWGHMAAHH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|