C23H21F4N3O3 — CID 155311205
N-[3-(1,1-difluoroethyl)phenyl]-1-[4-(difluoromethoxy)phenyl]-3-methyl-5-oxo-4-prop-2-enylpyrazole-4-carboxamide (PubChem CID 155311205) has the molecular formula C23H21F4N3O3 and a molecular weight of 463.43 g/mol. Its IUPAC name is N-[3-(1,1-difluoroethyl)phenyl]-1-[4-(difluoromethoxy)phenyl]-3-methyl-5-oxo-4-prop-2-enylpyrazole-4-carboxamide.
| Compound Name | N-[3-(1,1-difluoroethyl)phenyl]-1-[4-(difluoromethoxy)phenyl]-3-methyl-5-oxo-4-prop-2-enylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 155311205 |
| Molecular Formula | C23H21F4N3O3 |
| Molecular Weight | 463.43 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | N-[3-(1,1-difluoroethyl)phenyl]-1-[4-(difluoromethoxy)phenyl]-3-methyl-5-oxo-4-prop-2-enylpyrazole-4-carboxamide |
| SMILES | C=CCC1(C(=O)Nc2cccc(C(C)(F)F)c2)C(=O)N(c2ccc(OC(F)F)cc2)N=C1C |
| InChI | InChI=1S/C23H21F4N3O3/c1-4-12-23(19(31)28-16-7-5-6-15(13-16)22(3,26)27)14(2)29-30(20(23)32)17-8-10-18(11-9-17)33-21(24)25/h4-11,13,21H,1,12H2,2-3H3,(H,28,31) |
| InChIKey | YQWYEYUUMQYMSH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.43 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|