C21H21F4N3O3 — CID 155311346
N-[3-(1,1-difluoroethyl)phenyl]-N'-[4-(difluoromethoxy)phenyl]-2-ethanimidoyl-2-methylpropanediamide (PubChem CID 155311346) has the molecular formula C21H21F4N3O3 and a molecular weight of 439.41 g/mol. Its IUPAC name is N-[3-(1,1-difluoroethyl)phenyl]-N'-[4-(difluoromethoxy)phenyl]-2-ethanimidoyl-2-methylpropanediamide.
| Compound Name | N-[3-(1,1-difluoroethyl)phenyl]-N'-[4-(difluoromethoxy)phenyl]-2-ethanimidoyl-2-methylpropanediamide |
|---|---|
| PubChem CID | 155311346 |
| Molecular Formula | C21H21F4N3O3 |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | N-[3-(1,1-difluoroethyl)phenyl]-N'-[4-(difluoromethoxy)phenyl]-2-ethanimidoyl-2-methylpropanediamide |
| SMILES | [H]/N=C(\C)C(C)(C(=O)Nc1ccc(OC(F)F)cc1)C(=O)Nc1cccc(C(C)(F)F)c1 |
| InChI | InChI=1S/C21H21F4N3O3/c1-12(26)20(2,17(29)27-14-7-9-16(10-8-14)31-19(22)23)18(30)28-15-6-4-5-13(11-15)21(3,24)25/h4-11,19,26H,1-3H3,(H,27,29)(H,28,30)/b26-12+ |
| InChIKey | PCOXTNLXHMNAPH-RPPGKUMJSA-N |
| XLogP | 5.02 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|