C20H17ClF2N2O3 — CID 167611267
4-[2-(3-chloro-5-methylphenyl)acetyl]-2-[4-(difluoromethoxy)phenyl]-5-methyl-4H-pyrazol-3-one (PubChem CID 167611267) has the molecular formula C20H17ClF2N2O3 and a molecular weight of 406.82 g/mol. Its IUPAC name is 4-[2-(3-chloro-5-methylphenyl)acetyl]-2-[4-(difluoromethoxy)phenyl]-5-methyl-4H-pyrazol-3-one.
| Compound Name | 4-[2-(3-chloro-5-methylphenyl)acetyl]-2-[4-(difluoromethoxy)phenyl]-5-methyl-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 167611267 |
| Molecular Formula | C20H17ClF2N2O3 |
| Molecular Weight | 406.82 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 4-[2-(3-chloro-5-methylphenyl)acetyl]-2-[4-(difluoromethoxy)phenyl]-5-methyl-4H-pyrazol-3-one |
| SMILES | CC1=NN(c2ccc(OC(F)F)cc2)C(=O)C1C(=O)Cc1cc(C)cc(Cl)c1 |
| InChI | InChI=1S/C20H17ClF2N2O3/c1-11-7-13(9-14(21)8-11)10-17(26)18-12(2)24-25(19(18)27)15-3-5-16(6-4-15)28-20(22)23/h3-9,18,20H,10H2,1-2H3 |
| InChIKey | LBXOVDWNHNWDAP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.82 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|