C30H49F2N3O5Si2 — CID 162719487
N-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexyl]-1-[4-(difluoromethoxy)phenyl]-3-methyl-5-oxo-4H-pyrazole-4-carboxamide (PubChem CID 162719487) has the molecular formula C30H49F2N3O5Si2 and a molecular weight of 625.91 g/mol. Its IUPAC name is N-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexyl]-1-[4-(difluoromethoxy)phenyl]-3-methyl-5-oxo-4H-pyrazole-4-carboxamide.
| Compound Name | N-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexyl]-1-[4-(difluoromethoxy)phenyl]-3-methyl-5-oxo-4H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162719487 |
| Molecular Formula | C30H49F2N3O5Si2 |
| Molecular Weight | 625.91 g/mol |
| Exact Mass | 625.32 |
| IUPAC Name | N-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexyl]-1-[4-(difluoromethoxy)phenyl]-3-methyl-5-oxo-4H-pyrazole-4-carboxamide |
| SMILES | CC1=NN(c2ccc(OC(F)F)cc2)C(=O)C1C(=O)NC1CCC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C30H49F2N3O5Si2/c1-19-25(27(37)35(34-19)21-13-15-22(16-14-21)38-28(31)32)26(36)33-20-12-17-23(39-41(8,9)29(2,3)4)24(18-20)40-42(10,11)30(5,6)7/h13-16,20,23-25,28H,12,17-18H2,1-11H3,(H,33,36) |
| InChIKey | SSFGUNNJQPGJPO-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.91 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|