C20H18ClF2N3O4 — CID 139443242
N-(3-chloro-5-methoxyphenyl)-1-[4-(difluoromethoxy)phenyl]-N,3-dimethyl-5-oxo-4H-pyrazole-4-carboxamide (PubChem CID 139443242) has the molecular formula C20H18ClF2N3O4 and a molecular weight of 437.83 g/mol. Its IUPAC name is N-(3-chloro-5-methoxyphenyl)-1-[4-(difluoromethoxy)phenyl]-N,3-dimethyl-5-oxo-4H-pyrazole-4-carboxamide.
| Compound Name | N-(3-chloro-5-methoxyphenyl)-1-[4-(difluoromethoxy)phenyl]-N,3-dimethyl-5-oxo-4H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 139443242 |
| Molecular Formula | C20H18ClF2N3O4 |
| Molecular Weight | 437.83 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | N-(3-chloro-5-methoxyphenyl)-1-[4-(difluoromethoxy)phenyl]-N,3-dimethyl-5-oxo-4H-pyrazole-4-carboxamide |
| SMILES | COc1cc(Cl)cc(N(C)C(=O)C2C(=O)N(c3ccc(OC(F)F)cc3)N=C2C)c1 |
| InChI | InChI=1S/C20H18ClF2N3O4/c1-11-17(18(27)25(2)14-8-12(21)9-16(10-14)29-3)19(28)26(24-11)13-4-6-15(7-5-13)30-20(22)23/h4-10,17,20H,1-3H3 |
| InChIKey | GQSNQVCFUYPGTC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.83 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|