C18H13F2N5O3 — CID 155303763
N-(5-cyano-3-pyridinyl)-1-[4-(difluoromethoxy)phenyl]-3-methyl-5-oxo-4H-pyrazole-4-carboxamide (PubChem CID 155303763) has the molecular formula C18H13F2N5O3 and a molecular weight of 385.33 g/mol. Its IUPAC name is N-(5-cyano-3-pyridinyl)-1-[4-(difluoromethoxy)phenyl]-3-methyl-5-oxo-4H-pyrazole-4-carboxamide.
| Compound Name | N-(5-cyano-3-pyridinyl)-1-[4-(difluoromethoxy)phenyl]-3-methyl-5-oxo-4H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 155303763 |
| Molecular Formula | C18H13F2N5O3 |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N-(5-cyano-3-pyridinyl)-1-[4-(difluoromethoxy)phenyl]-3-methyl-5-oxo-4H-pyrazole-4-carboxamide |
| SMILES | CC1=NN(c2ccc(OC(F)F)cc2)C(=O)C1C(=O)Nc1cncc(C#N)c1 |
| InChI | InChI=1S/C18H13F2N5O3/c1-10-15(16(26)23-12-6-11(7-21)8-22-9-12)17(27)25(24-10)13-2-4-14(5-3-13)28-18(19)20/h2-6,8-9,15,18H,1H3,(H,23,26) |
| InChIKey | QFYLJZQDGYTUTP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|