C18H13ClF3N3O3 — CID 155311578
N-(3-chloro-5-fluorophenyl)-1-[4-(difluoromethoxy)phenyl]-3-methyl-5-oxo-4H-pyrazole-4-carboxamide (PubChem CID 155311578) has the molecular formula C18H13ClF3N3O3 and a molecular weight of 411.77 g/mol. Its IUPAC name is N-(3-chloro-5-fluorophenyl)-1-[4-(difluoromethoxy)phenyl]-3-methyl-5-oxo-4H-pyrazole-4-carboxamide.
| Compound Name | N-(3-chloro-5-fluorophenyl)-1-[4-(difluoromethoxy)phenyl]-3-methyl-5-oxo-4H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 155311578 |
| Molecular Formula | C18H13ClF3N3O3 |
| Molecular Weight | 411.77 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | N-(3-chloro-5-fluorophenyl)-1-[4-(difluoromethoxy)phenyl]-3-methyl-5-oxo-4H-pyrazole-4-carboxamide |
| SMILES | CC1=NN(c2ccc(OC(F)F)cc2)C(=O)C1C(=O)Nc1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C18H13ClF3N3O3/c1-9-15(16(26)23-12-7-10(19)6-11(20)8-12)17(27)25(24-9)13-2-4-14(5-3-13)28-18(21)22/h2-8,15,18H,1H3,(H,23,26) |
| InChIKey | DODHIQJNUJBPDG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.77 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|