C19H15BrF2IN3O2 — CID 155303125
1-(3-bromo-5-iodophenyl)-N-[3-(1,1-difluoroethyl)phenyl]-3-methyl-5-oxo-4H-pyrazole-4-carboxamide (PubChem CID 155303125) has the molecular formula C19H15BrF2IN3O2 and a molecular weight of 562.15 g/mol. Its IUPAC name is 1-(3-bromo-5-iodophenyl)-N-[3-(1,1-difluoroethyl)phenyl]-3-methyl-5-oxo-4H-pyrazole-4-carboxamide.
| Compound Name | 1-(3-bromo-5-iodophenyl)-N-[3-(1,1-difluoroethyl)phenyl]-3-methyl-5-oxo-4H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 155303125 |
| Molecular Formula | C19H15BrF2IN3O2 |
| Molecular Weight | 562.15 g/mol |
| Exact Mass | 560.94 |
| IUPAC Name | 1-(3-bromo-5-iodophenyl)-N-[3-(1,1-difluoroethyl)phenyl]-3-methyl-5-oxo-4H-pyrazole-4-carboxamide |
| SMILES | CC1=NN(c2cc(Br)cc(I)c2)C(=O)C1C(=O)Nc1cccc(C(C)(F)F)c1 |
| InChI | InChI=1S/C19H15BrF2IN3O2/c1-10-16(17(27)24-14-5-3-4-11(6-14)19(2,21)22)18(28)26(25-10)15-8-12(20)7-13(23)9-15/h3-9,16H,1-2H3,(H,24,27) |
| InChIKey | RQOXYGXVEAWZOP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.15 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|