C16H20N2O3 — CID 124634382
(1R,2R)-2-hydrazinyl-1,2-bis(4-methoxyphenyl)ethanol (PubChem CID 124634382) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is (1R,2R)-2-hydrazinyl-1,2-bis(4-methoxyphenyl)ethanol.
| Compound Name | (1R,2R)-2-hydrazinyl-1,2-bis(4-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 124634382 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (1R,2R)-2-hydrazinyl-1,2-bis(4-methoxyphenyl)ethanol |
| SMILES | COc1ccc([C@@H](O)[C@H](NN)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C16H20N2O3/c1-20-13-7-3-11(4-8-13)15(18-17)16(19)12-5-9-14(21-2)10-6-12/h3-10,15-16,18-19H,17H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | SWCPRAWTXYMESF-HZPDHXFCSA-N |
| XLogP | 1.94 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|