C16H23NOSi — CID 124636916
(2S)-N-ethyl-2-[4-(2-trimethylsilylethynyl)phenyl]propanamide (PubChem CID 124636916) has the molecular formula C16H23NOSi and a molecular weight of 273.45 g/mol. Its IUPAC name is (2S)-N-ethyl-2-[4-(2-trimethylsilylethynyl)phenyl]propanamide.
| Compound Name | (2S)-N-ethyl-2-[4-(2-trimethylsilylethynyl)phenyl]propanamide |
|---|---|
| PubChem CID | 124636916 |
| Molecular Formula | C16H23NOSi |
| Molecular Weight | 273.45 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | (2S)-N-ethyl-2-[4-(2-trimethylsilylethynyl)phenyl]propanamide |
| SMILES | CCNC(=O)[C@@H](C)c1ccc(C#C[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C16H23NOSi/c1-6-17-16(18)13(2)15-9-7-14(8-10-15)11-12-19(3,4)5/h7-10,13H,6H2,1-5H3,(H,17,18)/t13-/m0/s1 |
| InChIKey | ZDHDALREBXAMGJ-ZDUSSCGKSA-N |
| XLogP | 3.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|