C11H17N3O2 — CID 124637391
(3S,4S)-4-(4-amino-2-methoxyanilino)pyrrolidin-3-ol (PubChem CID 124637391) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is (3S,4S)-4-(4-amino-2-methoxyanilino)pyrrolidin-3-ol.
| Compound Name | (3S,4S)-4-(4-amino-2-methoxyanilino)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 124637391 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | (3S,4S)-4-(4-amino-2-methoxyanilino)pyrrolidin-3-ol |
| SMILES | COc1cc(N)ccc1N[C@H]1CNC[C@@H]1O |
| InChI | InChI=1S/C11H17N3O2/c1-16-11-4-7(12)2-3-8(11)14-9-5-13-6-10(9)15/h2-4,9-10,13-15H,5-6,12H2,1H3/t9-,10-/m0/s1 |
| InChIKey | DMNXNLJQDBPYAP-UWVGGRQHSA-N |
| XLogP | 0.02 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|