C7H9NO2S — CID 124638952
(Z,3S)-3-amino-2-thiophen-2-ylprop-1-ene-1,3-diol (PubChem CID 124638952) has the molecular formula C7H9NO2S and a molecular weight of 171.22 g/mol. Its IUPAC name is (Z,3S)-3-amino-2-thiophen-2-ylprop-1-ene-1,3-diol.
| Compound Name | (Z,3S)-3-amino-2-thiophen-2-ylprop-1-ene-1,3-diol |
|---|---|
| PubChem CID | 124638952 |
| Molecular Formula | C7H9NO2S |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.04 |
| IUPAC Name | (Z,3S)-3-amino-2-thiophen-2-ylprop-1-ene-1,3-diol |
| SMILES | N[C@@H](O)/C(=C/O)c1cccs1 |
| InChI | InChI=1S/C7H9NO2S/c8-7(10)5(4-9)6-2-1-3-11-6/h1-4,7,9-10H,8H2/b5-4+/t7-/m0/s1 |
| InChIKey | YXCQOWJAMGQYPU-KPJROHGDSA-N |
| XLogP | 0.92 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|