C14H14N4O2 — CID 124643676
(1R,7S,8R)-13-imino-11,12-dioxatricyclo[6.3.2.01,7]tridecane-8,9,9-tricarbonitrile (PubChem CID 124643676) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is (1R,7S,8R)-13-imino-11,12-dioxatricyclo[6.3.2.01,7]tridecane-8,9,9-tricarbonitrile.
| Compound Name | (1R,7S,8R)-13-imino-11,12-dioxatricyclo[6.3.2.01,7]tridecane-8,9,9-tricarbonitrile |
|---|---|
| PubChem CID | 124643676 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | (1R,7S,8R)-13-imino-11,12-dioxatricyclo[6.3.2.01,7]tridecane-8,9,9-tricarbonitrile |
| SMILES | [H]/N=C1\O[C@]23CCCCC[C@H]2[C@]1(C#N)C(C#N)(C#N)CO3 |
| InChI | InChI=1S/C14H14N4O2/c15-6-12(7-16)9-19-14-5-3-1-2-4-10(14)13(12,8-17)11(18)20-14/h10,18H,1-5,9H2/b18-11-/t10-,13-,14+/m0/s1 |
| InChIKey | HOQAFHDNCGYPQY-NMMRVTTDSA-N |
| XLogP | 1.84 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|