C19H11F5N4O2 — CID 3390768
12-imino-9-(2,3,4,5,6-pentafluorophenyl)-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile (PubChem CID 3390768) has the molecular formula C19H11F5N4O2 and a molecular weight of 422.31 g/mol. Its IUPAC name is 12-imino-9-(2,3,4,5,6-pentafluorophenyl)-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile.
| Compound Name | 12-imino-9-(2,3,4,5,6-pentafluorophenyl)-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile |
|---|---|
| PubChem CID | 3390768 |
| Molecular Formula | C19H11F5N4O2 |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 12-imino-9-(2,3,4,5,6-pentafluorophenyl)-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile |
| SMILES | [H]/N=C1/OC23CCCCC2C1(C#N)C(C#N)(C#N)C(c1c(F)c(F)c(F)c(F)c1F)O3 |
| InChI | InChI=1S/C19H11F5N4O2/c20-10-9(11(21)13(23)14(24)12(10)22)15-17(5-25,6-26)18(7-27)8-3-1-2-4-19(8,29-15)30-16(18)28/h8,15,28H,1-4H2/b28-16+ |
| InChIKey | XJOOKEZNIRUCQZ-LQKURTRISA-N |
| XLogP | 3.89 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|