C15H22O2 — CID 124645669
1,3-dimethoxy-5-[(1R,2R)-2-methylcyclohexyl]benzene (PubChem CID 124645669) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 1,3-dimethoxy-5-[(1R,2R)-2-methylcyclohexyl]benzene.
| Compound Name | 1,3-dimethoxy-5-[(1R,2R)-2-methylcyclohexyl]benzene |
|---|---|
| PubChem CID | 124645669 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 1,3-dimethoxy-5-[(1R,2R)-2-methylcyclohexyl]benzene |
| SMILES | COc1cc(OC)cc([C@@H]2CCCC[C@H]2C)c1 |
| InChI | InChI=1S/C15H22O2/c1-11-6-4-5-7-15(11)12-8-13(16-2)10-14(9-12)17-3/h8-11,15H,4-7H2,1-3H3/t11-,15-/m1/s1 |
| InChIKey | HNDQRSXEPXHHQD-IAQYHMDHSA-N |
| XLogP | 4.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |