C15H22N2 — CID 124647429
(3R)-3,4,4-trimethyl-1,11-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-triene (PubChem CID 124647429) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is (3R)-3,4,4-trimethyl-1,11-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-triene.
| Compound Name | (3R)-3,4,4-trimethyl-1,11-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-triene |
|---|---|
| PubChem CID | 124647429 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (3R)-3,4,4-trimethyl-1,11-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-triene |
| SMILES | C[C@H]1CN2CCNCc3cccc(c32)C1(C)C |
| InChI | InChI=1S/C15H22N2/c1-11-10-17-8-7-16-9-12-5-4-6-13(14(12)17)15(11,2)3/h4-6,11,16H,7-10H2,1-3H3/t11-/m0/s1 |
| InChIKey | NABGIQANRBKJGO-NSHDSACASA-N |
| XLogP | 2.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |