C27H29N3O6S — CID 124665716
2-[4-[(E)-[3-(2-morpholin-4-yl-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2-propan-2-ylphenyl)acetamide (PubChem CID 124665716) has the molecular formula C27H29N3O6S and a molecular weight of 523.61 g/mol. Its IUPAC name is 2-[4-[(E)-[3-(2-morpholin-4-yl-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[4-[(E)-[3-(2-morpholin-4-yl-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 124665716 |
| Molecular Formula | C27H29N3O6S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | 2-[4-[(E)-[3-(2-morpholin-4-yl-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccccc1NC(=O)COc1ccc(/C=C2/SC(=O)N(CC(=O)N3CCOCC3)C2=O)cc1 |
| InChI | InChI=1S/C27H29N3O6S/c1-18(2)21-5-3-4-6-22(21)28-24(31)17-36-20-9-7-19(8-10-20)15-23-26(33)30(27(34)37-23)16-25(32)29-11-13-35-14-12-29/h3-10,15,18H,11-14,16-17H2,1-2H3,(H,28,31)/b23-15+ |
| InChIKey | KAYBVWKHXAEUGN-HZHRSRAPSA-N |
| XLogP | 3.72 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|