C31H31N3O5S — CID 126162641
N-(2,6-dimethylphenyl)-2-[(5E)-2,4-dioxo-5-[[4-[2-oxo-2-(2-propan-2-ylanilino)ethoxy]phenyl]methylidene]-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126162641) has the molecular formula C31H31N3O5S and a molecular weight of 557.67 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[(5E)-2,4-dioxo-5-[[4-[2-oxo-2-(2-propan-2-ylanilino)ethoxy]phenyl]methylidene]-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[(5E)-2,4-dioxo-5-[[4-[2-oxo-2-(2-propan-2-ylanilino)ethoxy]phenyl]methylidene]-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126162641 |
| Molecular Formula | C31H31N3O5S |
| Molecular Weight | 557.67 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[(5E)-2,4-dioxo-5-[[4-[2-oxo-2-(2-propan-2-ylanilino)ethoxy]phenyl]methylidene]-1,3-thiazolidin-3-yl]acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN1C(=O)S/C(=C/c2ccc(OCC(=O)Nc3ccccc3C(C)C)cc2)C1=O |
| InChI | InChI=1S/C31H31N3O5S/c1-19(2)24-10-5-6-11-25(24)32-28(36)18-39-23-14-12-22(13-15-23)16-26-30(37)34(31(38)40-26)17-27(35)33-29-20(3)8-7-9-21(29)4/h5-16,19H,17-18H2,1-4H3,(H,32,36)(H,33,35)/b26-16+ |
| InChIKey | FKAXKQAZGRFNAX-WGOQTCKBSA-N |
| XLogP | 6.12 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.67 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|