C30H29N3O5S2 — CID 126163419
2-[(5E)-2,4-dioxo-5-[[4-[2-oxo-2-(2-propan-2-ylanilino)ethoxy]phenyl]methylidene]-1,3-thiazolidin-3-yl]-N-(3-methylsulfanylphenyl)acetamide (PubChem CID 126163419) has the molecular formula C30H29N3O5S2 and a molecular weight of 575.71 g/mol. Its IUPAC name is 2-[(5E)-2,4-dioxo-5-[[4-[2-oxo-2-(2-propan-2-ylanilino)ethoxy]phenyl]methylidene]-1,3-thiazolidin-3-yl]-N-(3-methylsulfanylphenyl)acetamide.
| Compound Name | 2-[(5E)-2,4-dioxo-5-[[4-[2-oxo-2-(2-propan-2-ylanilino)ethoxy]phenyl]methylidene]-1,3-thiazolidin-3-yl]-N-(3-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 126163419 |
| Molecular Formula | C30H29N3O5S2 |
| Molecular Weight | 575.71 g/mol |
| Exact Mass | 575.15 |
| IUPAC Name | 2-[(5E)-2,4-dioxo-5-[[4-[2-oxo-2-(2-propan-2-ylanilino)ethoxy]phenyl]methylidene]-1,3-thiazolidin-3-yl]-N-(3-methylsulfanylphenyl)acetamide |
| SMILES | CSc1cccc(NC(=O)CN2C(=O)S/C(=C/c3ccc(OCC(=O)Nc4ccccc4C(C)C)cc3)C2=O)c1 |
| InChI | InChI=1S/C30H29N3O5S2/c1-19(2)24-9-4-5-10-25(24)32-28(35)18-38-22-13-11-20(12-14-22)15-26-29(36)33(30(37)40-26)17-27(34)31-21-7-6-8-23(16-21)39-3/h4-16,19H,17-18H2,1-3H3,(H,31,34)(H,32,35)/b26-15+ |
| InChIKey | UVCSNKBCYLLVBY-CVKSISIWSA-N |
| XLogP | 6.22 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.71 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|