C24H25N3O6S — CID 124665789
methyl 2-[2,5-dimethyl-3-[(E)-[3-(2-morpholin-4-yl-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]pyrrol-1-yl]benzoate (PubChem CID 124665789) has the molecular formula C24H25N3O6S and a molecular weight of 483.55 g/mol. Its IUPAC name is methyl 2-[2,5-dimethyl-3-[(E)-[3-(2-morpholin-4-yl-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]pyrrol-1-yl]benzoate.
| Compound Name | methyl 2-[2,5-dimethyl-3-[(E)-[3-(2-morpholin-4-yl-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 124665789 |
| Molecular Formula | C24H25N3O6S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | methyl 2-[2,5-dimethyl-3-[(E)-[3-(2-morpholin-4-yl-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]pyrrol-1-yl]benzoate |
| SMILES | COC(=O)c1ccccc1-n1c(C)cc(/C=C2/SC(=O)N(CC(=O)N3CCOCC3)C2=O)c1C |
| InChI | InChI=1S/C24H25N3O6S/c1-15-12-17(16(2)27(15)19-7-5-4-6-18(19)23(30)32-3)13-20-22(29)26(24(31)34-20)14-21(28)25-8-10-33-11-9-25/h4-7,12-13H,8-11,14H2,1-3H3/b20-13+ |
| InChIKey | XHLBLRCQDYVGII-DEDYPNTBSA-N |
| XLogP | 2.78 |
| TPSA | 98.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|