C26H22FN3O5S — CID 4267050
methyl 2-[3-[[3-[2-(2-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 4267050) has the molecular formula C26H22FN3O5S and a molecular weight of 507.54 g/mol. Its IUPAC name is methyl 2-[3-[[3-[2-(2-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | methyl 2-[3-[[3-[2-(2-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 4267050 |
| Molecular Formula | C26H22FN3O5S |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | methyl 2-[3-[[3-[2-(2-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | COC(=O)c1ccccc1-n1c(C)cc(C=C2SC(=O)N(CC(=O)Nc3ccccc3F)C2=O)c1C |
| InChI | InChI=1S/C26H22FN3O5S/c1-15-12-17(16(2)30(15)21-11-7-4-8-18(21)25(33)35-3)13-22-24(32)29(26(34)36-22)14-23(31)28-20-10-6-5-9-19(20)27/h4-13H,14H2,1-3H3,(H,28,31) |
| InChIKey | CHNBTSUYEWFGCB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|