C29H29Cl2NO3S — CID 124666589
(5E)-5-[[5-(1-adamantyl)-2-ethoxyphenyl]methylidene]-3-[(3,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 124666589) has the molecular formula C29H29Cl2NO3S and a molecular weight of 542.53 g/mol. Its IUPAC name is (5E)-5-[[5-(1-adamantyl)-2-ethoxyphenyl]methylidene]-3-[(3,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[5-(1-adamantyl)-2-ethoxyphenyl]methylidene]-3-[(3,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124666589 |
| Molecular Formula | C29H29Cl2NO3S |
| Molecular Weight | 542.53 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | (5E)-5-[[5-(1-adamantyl)-2-ethoxyphenyl]methylidene]-3-[(3,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1ccc(C23CC4CC(CC(C4)C2)C3)cc1/C=C1/SC(=O)N(Cc2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C29H29Cl2NO3S/c1-2-35-25-6-4-22(29-13-18-7-19(14-29)9-20(8-18)15-29)11-21(25)12-26-27(33)32(28(34)36-26)16-17-3-5-23(30)24(31)10-17/h3-6,10-12,18-20H,2,7-9,13-16H2,1H3/b26-12+ |
| InChIKey | LKJVCTFHANHZBS-RPPGKUMJSA-N |
| XLogP | 8.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.53 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|