C30H31BrN2O4S — CID 126188314
2-[(5E)-5-[[5-(1-adamantyl)-2-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-bromophenyl)acetamide (PubChem CID 126188314) has the molecular formula C30H31BrN2O4S and a molecular weight of 595.56 g/mol. Its IUPAC name is 2-[(5E)-5-[[5-(1-adamantyl)-2-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-bromophenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[5-(1-adamantyl)-2-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-bromophenyl)acetamide |
|---|---|
| PubChem CID | 126188314 |
| Molecular Formula | C30H31BrN2O4S |
| Molecular Weight | 595.56 g/mol |
| Exact Mass | 594.12 |
| IUPAC Name | 2-[(5E)-5-[[5-(1-adamantyl)-2-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-bromophenyl)acetamide |
| SMILES | CCOc1ccc(C23CC4CC(CC(C4)C2)C3)cc1/C=C1/SC(=O)N(CC(=O)Nc2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C30H31BrN2O4S/c1-2-37-25-8-3-22(30-14-18-9-19(15-30)11-20(10-18)16-30)12-21(25)13-26-28(35)33(29(36)38-26)17-27(34)32-24-6-4-23(31)5-7-24/h3-8,12-13,18-20H,2,9-11,14-17H2,1H3,(H,32,34)/b26-13+ |
| InChIKey | HUNAXTLUZGWGDY-LGJNPRDNSA-N |
| XLogP | 6.99 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.56 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|