C30H30N2O6S — CID 126280311
(5E)-5-[[5-(1-adamantyl)-2-ethoxyphenyl]methylidene]-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126280311) has the molecular formula C30H30N2O6S and a molecular weight of 546.65 g/mol. Its IUPAC name is (5E)-5-[[5-(1-adamantyl)-2-ethoxyphenyl]methylidene]-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[5-(1-adamantyl)-2-ethoxyphenyl]methylidene]-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126280311 |
| Molecular Formula | C30H30N2O6S |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | (5E)-5-[[5-(1-adamantyl)-2-ethoxyphenyl]methylidene]-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1ccc(C23CC4CC(CC(C4)C2)C3)cc1/C=C1/SC(=O)N(CC(=O)c2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C30H30N2O6S/c1-2-38-26-8-5-23(30-14-18-9-19(15-30)11-20(10-18)16-30)12-22(26)13-27-28(34)31(29(35)39-27)17-25(33)21-3-6-24(7-4-21)32(36)37/h3-8,12-13,18-20H,2,9-11,14-17H2,1H3/b27-13+ |
| InChIKey | MYLXOQVOMLOKBG-UVHMKAGCSA-N |
| XLogP | 6.38 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|