C22H14ClFN2O6S — CID 124667612
(5E)-3-[(2-chloro-4-fluorophenyl)methyl]-5-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 124667612) has the molecular formula C22H14ClFN2O6S and a molecular weight of 488.88 g/mol. Its IUPAC name is (5E)-3-[(2-chloro-4-fluorophenyl)methyl]-5-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(2-chloro-4-fluorophenyl)methyl]-5-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124667612 |
| Molecular Formula | C22H14ClFN2O6S |
| Molecular Weight | 488.88 g/mol |
| Exact Mass | 488.02 |
| IUPAC Name | (5E)-3-[(2-chloro-4-fluorophenyl)methyl]-5-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(-c2ccc(/C=C3/SC(=O)N(Cc4ccc(F)cc4Cl)C3=O)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H14ClFN2O6S/c1-31-14-4-6-16(18(9-14)26(29)30)19-7-5-15(32-19)10-20-21(27)25(22(28)33-20)11-12-2-3-13(24)8-17(12)23/h2-10H,11H2,1H3/b20-10+ |
| InChIKey | AEJKXRYMIATSRV-KEBDBYFISA-N |
| XLogP | 5.89 |
| TPSA | 102.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.88 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|