C12H13BrN2O2 — CID 124672916
(5S)-5-[2-(2-bromophenyl)ethyl]-5-methylimidazolidine-2,4-dione (PubChem CID 124672916) has the molecular formula C12H13BrN2O2 and a molecular weight of 297.15 g/mol. Its IUPAC name is (5S)-5-[2-(2-bromophenyl)ethyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-[2-(2-bromophenyl)ethyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 124672916 |
| Molecular Formula | C12H13BrN2O2 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | (5S)-5-[2-(2-bromophenyl)ethyl]-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@@]1(CCc2ccccc2Br)NC(=O)NC1=O |
| InChI | InChI=1S/C12H13BrN2O2/c1-12(10(16)14-11(17)15-12)7-6-8-4-2-3-5-9(8)13/h2-5H,6-7H2,1H3,(H2,14,15,16,17)/t12-/m0/s1 |
| InChIKey | PHGMPLPMYXXGEI-LBPRGKRZSA-N |
| XLogP | 1.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|