C32H31BrN4O4 — CID 158732289
5-[2-(4-bromophenyl)ethyl]-5-methylimidazolidine-2,4-dione;5-methyl-5-[2-[4-(2-phenylethynyl)phenyl]ethyl]imidazolidine-2,4-dione (PubChem CID 158732289) has the molecular formula C32H31BrN4O4 and a molecular weight of 615.53 g/mol. Its IUPAC name is 5-[2-(4-bromophenyl)ethyl]-5-methylimidazolidine-2,4-dione;5-methyl-5-[2-[4-(2-phenylethynyl)phenyl]ethyl]imidazolidine-2,4-dione.
| Compound Name | 5-[2-(4-bromophenyl)ethyl]-5-methylimidazolidine-2,4-dione;5-methyl-5-[2-[4-(2-phenylethynyl)phenyl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 158732289 |
| Molecular Formula | C32H31BrN4O4 |
| Molecular Weight | 615.53 g/mol |
| Exact Mass | 614.15 |
| IUPAC Name | 5-[2-(4-bromophenyl)ethyl]-5-methylimidazolidine-2,4-dione;5-methyl-5-[2-[4-(2-phenylethynyl)phenyl]ethyl]imidazolidine-2,4-dione |
| SMILES | CC1(CCc2ccc(Br)cc2)NC(=O)NC1=O.CC1(CCc2ccc(C#Cc3ccccc3)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C20H18N2O2.C12H13BrN2O2/c1-20(18(23)21-19(24)22-20)14-13-17-11-9-16(10-12-17)8-7-15-5-3-2-4-6-15;1-12(10(16)14-11(17)15-12)7-6-8-2-4-9(13)5-3-8/h2-6,9-12H,13-14H2,1H3,(H2,21,22,23,24);2-5H,6-7H2,1H3,(H2,14,15,16,17) |
| InChIKey | ILFYWOHYZOBVQU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|