C12H9N3 — CID 124673889
(2R)-2-(4-methylphenyl)ethane-1,1,2-tricarbonitrile (PubChem CID 124673889) has the molecular formula C12H9N3 and a molecular weight of 195.22 g/mol. Its IUPAC name is (2R)-2-(4-methylphenyl)ethane-1,1,2-tricarbonitrile.
| Compound Name | (2R)-2-(4-methylphenyl)ethane-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 124673889 |
| Molecular Formula | C12H9N3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | (2R)-2-(4-methylphenyl)ethane-1,1,2-tricarbonitrile |
| SMILES | Cc1ccc([C@H](C#N)C(C#N)C#N)cc1 |
| InChI | InChI=1S/C12H9N3/c1-9-2-4-10(5-3-9)12(8-15)11(6-13)7-14/h2-5,11-12H,1H3/t12-/m0/s1 |
| InChIKey | AWXFODOTCMJDHR-LBPRGKRZSA-N |
| XLogP | 2.27 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |