C17H27N2O+ — CID 124680137
1-butyl-3-[[(2R)-2-methylbutoxy]methyl]benzimidazol-3-ium (PubChem CID 124680137) has the molecular formula C17H27N2O+ and a molecular weight of 275.42 g/mol. Its IUPAC name is 1-butyl-3-[[(2R)-2-methylbutoxy]methyl]benzimidazol-3-ium.
| Compound Name | 1-butyl-3-[[(2R)-2-methylbutoxy]methyl]benzimidazol-3-ium |
|---|---|
| PubChem CID | 124680137 |
| Molecular Formula | C17H27N2O+ |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | 1-butyl-3-[[(2R)-2-methylbutoxy]methyl]benzimidazol-3-ium |
| SMILES | CCCCn1c[n+](COC[C@H](C)CC)c2ccccc21 |
| InChI | InChI=1S/C17H27N2O/c1-4-6-11-18-13-19(14-20-12-15(3)5-2)17-10-8-7-9-16(17)18/h7-10,13,15H,4-6,11-12,14H2,1-3H3/q+1/t15-/m1/s1 |
| InChIKey | ZTAZXDIYROQALU-OAHLLOKOSA-N |
| XLogP | 3.75 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|