C27H34N4+2 — CID 139070007
1-(3-methylbut-2-enyl)-3-[3-[3-(3-methylbut-2-enyl)benzimidazol-3-ium-1-yl]propyl]benzimidazol-1-ium (PubChem CID 139070007) has the molecular formula C27H34N4+2 and a molecular weight of 414.60 g/mol. Its IUPAC name is 1-(3-methylbut-2-enyl)-3-[3-[3-(3-methylbut-2-enyl)benzimidazol-3-ium-1-yl]propyl]benzimidazol-1-ium.
| Compound Name | 1-(3-methylbut-2-enyl)-3-[3-[3-(3-methylbut-2-enyl)benzimidazol-3-ium-1-yl]propyl]benzimidazol-1-ium |
|---|---|
| PubChem CID | 139070007 |
| Molecular Formula | C27H34N4+2 |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | 1-(3-methylbut-2-enyl)-3-[3-[3-(3-methylbut-2-enyl)benzimidazol-3-ium-1-yl]propyl]benzimidazol-1-ium |
| SMILES | CC(C)=CC[n+]1cn(CCCn2c[n+](CC=C(C)C)c3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C27H34N4/c1-22(2)14-18-30-20-28(24-10-5-7-12-26(24)30)16-9-17-29-21-31(19-15-23(3)4)27-13-8-6-11-25(27)29/h5-8,10-15,20-21H,9,16-19H2,1-4H3/q+2 |
| InChIKey | LHKUQDKUTSOKPR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|