C20H26F2N2O — CID 124683676
(1S,2R)-2-[[4-(diethylamino)phenyl]methylamino]-1-(3,4-difluorophenyl)propan-1-ol (PubChem CID 124683676) has the molecular formula C20H26F2N2O and a molecular weight of 348.44 g/mol. Its IUPAC name is (1S,2R)-2-[[4-(diethylamino)phenyl]methylamino]-1-(3,4-difluorophenyl)propan-1-ol.
| Compound Name | (1S,2R)-2-[[4-(diethylamino)phenyl]methylamino]-1-(3,4-difluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 124683676 |
| Molecular Formula | C20H26F2N2O |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (1S,2R)-2-[[4-(diethylamino)phenyl]methylamino]-1-(3,4-difluorophenyl)propan-1-ol |
| SMILES | CCN(CC)c1ccc(CN[C@H](C)[C@@H](O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C20H26F2N2O/c1-4-24(5-2)17-9-6-15(7-10-17)13-23-14(3)20(25)16-8-11-18(21)19(22)12-16/h6-12,14,20,23,25H,4-5,13H2,1-3H3/t14-,20-/m1/s1 |
| InChIKey | OXHLUDLXGDOQJA-JLTOFOAXSA-N |
| XLogP | 4.02 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|