C19H26FNO3 — CID 124688333
3-[(3R)-1-[(2S)-4-(3-fluorophenyl)-2-methylbutanoyl]piperidin-3-yl]propanoic acid (PubChem CID 124688333) has the molecular formula C19H26FNO3 and a molecular weight of 335.42 g/mol. Its IUPAC name is 3-[(3R)-1-[(2S)-4-(3-fluorophenyl)-2-methylbutanoyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3R)-1-[(2S)-4-(3-fluorophenyl)-2-methylbutanoyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 124688333 |
| Molecular Formula | C19H26FNO3 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 3-[(3R)-1-[(2S)-4-(3-fluorophenyl)-2-methylbutanoyl]piperidin-3-yl]propanoic acid |
| SMILES | C[C@@H](CCc1cccc(F)c1)C(=O)N1CCC[C@H](CCC(=O)O)C1 |
| InChI | InChI=1S/C19H26FNO3/c1-14(7-8-15-4-2-6-17(20)12-15)19(24)21-11-3-5-16(13-21)9-10-18(22)23/h2,4,6,12,14,16H,3,5,7-11,13H2,1H3,(H,22,23)/t14-,16+/m0/s1 |
| InChIKey | UTUSYXHSCNLBGW-GOEBONIOSA-N |
| XLogP | 3.50 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |