C11H20O — CID 124705432
(1S,2S,5R)-4,4,6,6-tetramethylbicyclo[3.1.1]heptan-2-ol (PubChem CID 124705432) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (1S,2S,5R)-4,4,6,6-tetramethylbicyclo[3.1.1]heptan-2-ol.
| Compound Name | (1S,2S,5R)-4,4,6,6-tetramethylbicyclo[3.1.1]heptan-2-ol |
|---|---|
| PubChem CID | 124705432 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (1S,2S,5R)-4,4,6,6-tetramethylbicyclo[3.1.1]heptan-2-ol |
| SMILES | CC1(C)C[C@H](O)[C@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C11H20O/c1-10(2)6-8(12)7-5-9(10)11(7,3)4/h7-9,12H,5-6H2,1-4H3/t7-,8+,9-/m1/s1 |
| InChIKey | NAPJKRFCVPSZKH-HRDYMLBCSA-N |
| XLogP | 2.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |