C12H22O2 — CID 10559883
(1R,3aR,4S,6S,7aR)-3,3,6-trimethyl-1,2,3a,4,5,6,7,7a-octahydroindene-1,4-diol (PubChem CID 10559883) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (1R,3aR,4S,6S,7aR)-3,3,6-trimethyl-1,2,3a,4,5,6,7,7a-octahydroindene-1,4-diol.
| Compound Name | (1R,3aR,4S,6S,7aR)-3,3,6-trimethyl-1,2,3a,4,5,6,7,7a-octahydroindene-1,4-diol |
|---|---|
| PubChem CID | 10559883 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (1R,3aR,4S,6S,7aR)-3,3,6-trimethyl-1,2,3a,4,5,6,7,7a-octahydroindene-1,4-diol |
| SMILES | C[C@H]1C[C@@H]2[C@@H]([C@@H](O)C1)C(C)(C)C[C@H]2O |
| InChI | InChI=1S/C12H22O2/c1-7-4-8-10(14)6-12(2,3)11(8)9(13)5-7/h7-11,13-14H,4-6H2,1-3H3/t7-,8-,9-,10+,11-/m0/s1 |
| InChIKey | RMZKIVVJJDSMGF-MFDAYCCISA-N |
| XLogP | 1.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |