C5H10BrN — CID 124706809
[(1S,2R)-2-bromo-1-methylcyclopropyl]methanamine (PubChem CID 124706809) has the molecular formula C5H10BrN and a molecular weight of 164.05 g/mol. Its IUPAC name is [(1S,2R)-2-bromo-1-methylcyclopropyl]methanamine.
| Compound Name | [(1S,2R)-2-bromo-1-methylcyclopropyl]methanamine |
|---|---|
| PubChem CID | 124706809 |
| Molecular Formula | C5H10BrN |
| Molecular Weight | 164.05 g/mol |
| Exact Mass | 163.00 |
| IUPAC Name | [(1S,2R)-2-bromo-1-methylcyclopropyl]methanamine |
| SMILES | C[C@@]1(CN)C[C@H]1Br |
| InChI | InChI=1S/C5H10BrN/c1-5(3-7)2-4(5)6/h4H,2-3,7H2,1H3/t4-,5+/m1/s1 |
| InChIKey | QCKWPWCTVIBNIY-UHNVWZDZSA-N |
| XLogP | 1.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.05 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|