C8H7IN2 — CID 124706866
6-iodo-5-methylimidazo[1,2-a]pyridine (PubChem CID 124706866) has the molecular formula C8H7IN2 and a molecular weight of 258.06 g/mol. Its IUPAC name is 6-iodo-5-methylimidazo[1,2-a]pyridine.
| Compound Name | 6-iodo-5-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 124706866 |
| Molecular Formula | C8H7IN2 |
| Molecular Weight | 258.06 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | 6-iodo-5-methylimidazo[1,2-a]pyridine |
| SMILES | Cc1c(I)ccc2nccn12 |
| InChI | InChI=1S/C8H7IN2/c1-6-7(9)2-3-8-10-4-5-11(6)8/h2-5H,1H3 |
| InChIKey | PJHLVOADGHQRGA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.06 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|