C10H11ClN2 — CID 171768743
5-chloro-6-propan-2-ylimidazo[1,2-a]pyridine (PubChem CID 171768743) has the molecular formula C10H11ClN2 and a molecular weight of 194.66 g/mol. Its IUPAC name is 5-chloro-6-propan-2-ylimidazo[1,2-a]pyridine.
| Compound Name | 5-chloro-6-propan-2-ylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 171768743 |
| Molecular Formula | C10H11ClN2 |
| Molecular Weight | 194.66 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 5-chloro-6-propan-2-ylimidazo[1,2-a]pyridine |
| SMILES | CC(C)c1ccc2nccn2c1Cl |
| InChI | InChI=1S/C10H11ClN2/c1-7(2)8-3-4-9-12-5-6-13(9)10(8)11/h3-7H,1-2H3 |
| InChIKey | AKWGUROATOKKKI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.66 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|