C7H4ClIN2 — CID 76849501
5-chloro-6-iodoimidazo[1,2-a]pyridine (PubChem CID 76849501) has the molecular formula C7H4ClIN2 and a molecular weight of 278.48 g/mol. Its IUPAC name is 5-chloro-6-iodoimidazo[1,2-a]pyridine.
| Compound Name | 5-chloro-6-iodoimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 76849501 |
| Molecular Formula | C7H4ClIN2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 277.91 |
| IUPAC Name | 5-chloro-6-iodoimidazo[1,2-a]pyridine |
| SMILES | Clc1c(I)ccc2nccn12 |
| InChI | InChI=1S/C7H4ClIN2/c8-7-5(9)1-2-6-10-3-4-11(6)7/h1-4H |
| InChIKey | LECMGIRGSWYLLC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|